About 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole
3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole (PubChem CID 6618861) has the molecular formula C20H20N2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole.
Molecular Properties
| Compound Name | 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole |
| PubChem CID | 6618861 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole |
| SMILES | C1=C(c2c[nH]c3ccccc23)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H20N2/c1-2-6-16(7-3-1)15-22-12-10-17(11-13-22)19-14-21-20-9-5-4-8-18(19)20/h1-10,14,21H,11-13,15H2 |
| InChIKey | TYKXLUMYKFFSJE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole?
The IUPAC name of 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole (CID 6618861) is 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole.
What is the SMILES notation for 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole?
The canonical SMILES for 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole is C1=C(c2c[nH]c3ccccc23)CCN(Cc2ccccc2)C1.
What is the InChIKey of 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole?
The InChIKey is TYKXLUMYKFFSJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2/c1-2-6-16(7-3-1)15-22-12-10-17(11-13-22)19-14-21-20-9-5-4-8-18(19)20/h1-10,14,21H,11-13,15H2.
What are the key properties of 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole?
3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole has a molecular weight of 288.39 g/mol, XLogP of 4.46, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole is sourced from PubChem (CID 6618861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).