C12H14BrN5O3 — CID 66188672
2-(2-azidoethylamino)-2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)acetamide (PubChem CID 66188672) has the molecular formula C12H14BrN5O3 and a molecular weight of 356.18 g/mol. Its IUPAC name is 2-(2-azidoethylamino)-2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)acetamide.
| Compound Name | 2-(2-azidoethylamino)-2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)acetamide |
|---|---|
| PubChem CID | 66188672 |
| Molecular Formula | C12H14BrN5O3 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 2-(2-azidoethylamino)-2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)acetamide |
| SMILES | [N-]=[N+]=NCCNC(C(N)=O)c1cc(Br)c2c(c1)OCCO2 |
| InChI | InChI=1S/C12H14BrN5O3/c13-8-5-7(6-9-11(8)21-4-3-20-9)10(12(14)19)16-1-2-17-18-15/h5-6,10,16H,1-4H2,(H2,14,19) |
| InChIKey | JDUOZZIIKAFMSN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|