About methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate
methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate (PubChem CID 6618875) has the molecular formula C14H13N3O3
and a molecular weight of 271.28 g/mol. Its IUPAC name is methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate |
| PubChem CID | 6618875 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate |
| SMILES | COC(=O)Cn1c2ccccc2c2nc(=O)cc(C)n21 |
| InChI | InChI=1S/C14H13N3O3/c1-9-7-12(18)15-14-10-5-3-4-6-11(10)16(17(9)14)8-13(19)20-2/h3-7H,8H2,1-2H3 |
| InChIKey | KFRIGOBBELDORW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate?
The IUPAC name of methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate (CID 6618875) is methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate.
What is the SMILES notation for methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate?
The canonical SMILES for methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate is COC(=O)Cn1c2ccccc2c2nc(=O)cc(C)n21.
What is the InChIKey of methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate?
The InChIKey is KFRIGOBBELDORW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O3/c1-9-7-12(18)15-14-10-5-3-4-6-11(10)16(17(9)14)8-13(19)20-2/h3-7H,8H2,1-2H3.
What are the key properties of methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate?
methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate has a molecular weight of 271.28 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-methyl-2-oxopyrimido[1,2-b]indazol-6-yl)acetate is sourced from PubChem (CID 6618875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).