About [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine
[2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine (PubChem CID 66188763) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine |
| PubChem CID | 66188763 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine |
| SMILES | COCc1cc(COC2CCCCC2CN)no1 |
| InChI | InChI=1S/C13H22N2O3/c1-16-9-12-6-11(15-18-12)8-17-13-5-3-2-4-10(13)7-14/h6,10,13H,2-5,7-9,14H2,1H3 |
| InChIKey | AQSPIIRVDMICGI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine?
The IUPAC name of [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine (CID 66188763) is [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine.
What is the SMILES notation for [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine?
The canonical SMILES for [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine is COCc1cc(COC2CCCCC2CN)no1.
What is the InChIKey of [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine?
The InChIKey is AQSPIIRVDMICGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3/c1-16-9-12-6-11(15-18-12)8-17-13-5-3-2-4-10(13)7-14/h6,10,13H,2-5,7-9,14H2,1H3.
What are the key properties of [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine?
[2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine has a molecular weight of 254.33 g/mol, XLogP of 1.86, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]cyclohexyl]methanamine is sourced from PubChem (CID 66188763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).