C11H20N4O2 — CID 66188811
1-(2-azidoethylamino)-2,3-dimethylcyclohexane-1-carboxylic acid (PubChem CID 66188811) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-(2-azidoethylamino)-2,3-dimethylcyclohexane-1-carboxylic acid.
| Compound Name | 1-(2-azidoethylamino)-2,3-dimethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 66188811 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-(2-azidoethylamino)-2,3-dimethylcyclohexane-1-carboxylic acid |
| SMILES | CC1CCCC(NCCN=[N+]=[N-])(C(=O)O)C1C |
| InChI | InChI=1S/C11H20N4O2/c1-8-4-3-5-11(9(8)2,10(16)17)13-6-7-14-15-12/h8-9,13H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | IUNXUFIPNQTNIK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|