About 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid
1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid (PubChem CID 66188954) has the molecular formula C14H16N2O5
and a molecular weight of 292.29 g/mol. Its IUPAC name is 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid |
| PubChem CID | 66188954 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid |
| SMILES | COCc1cc(Cn2c(C)cc(C)c(C(=O)O)c2=O)no1 |
| InChI | InChI=1S/C14H16N2O5/c1-8-4-9(2)16(13(17)12(8)14(18)19)6-10-5-11(7-20-3)21-15-10/h4-5H,6-7H2,1-3H3,(H,18,19) |
| InChIKey | KCEOPWKGWAMJJS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid?
The IUPAC name of 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid (CID 66188954) is 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid.
What is the SMILES notation for 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid?
The canonical SMILES for 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid is COCc1cc(Cn2c(C)cc(C)c(C(=O)O)c2=O)no1.
What is the InChIKey of 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid?
The InChIKey is KCEOPWKGWAMJJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O5/c1-8-4-9(2)16(13(17)12(8)14(18)19)6-10-5-11(7-20-3)21-15-10/h4-5H,6-7H2,1-3H3,(H,18,19).
What are the key properties of 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid?
1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid has a molecular weight of 292.29 g/mol, XLogP of 1.35, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]-4,6-dimethyl-2-oxopyridine-3-carboxylic acid is sourced from PubChem (CID 66188954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).