About 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine
4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine (PubChem CID 6618933) has the molecular formula C10H14ClN3O
and a molecular weight of 227.69 g/mol. Its IUPAC name is 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine |
| PubChem CID | 6618933 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(c2ccc(Cl)nn2)CC(C)O1 |
| InChI | InChI=1S/C10H14ClN3O/c1-7-5-14(6-8(2)15-7)10-4-3-9(11)12-13-10/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | VPUHTJTZKNOQKX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine?
The IUPAC name of 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine (CID 6618933) is 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine.
What is the SMILES notation for 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine?
The canonical SMILES for 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine is CC1CN(c2ccc(Cl)nn2)CC(C)O1.
What is the InChIKey of 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine?
The InChIKey is VPUHTJTZKNOQKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3O/c1-7-5-14(6-8(2)15-7)10-4-3-9(11)12-13-10/h3-4,7-8H,5-6H2,1-2H3.
What are the key properties of 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine?
4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine has a molecular weight of 227.69 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-chloropyridazin-3-yl)-2,6-dimethylmorpholine is sourced from PubChem (CID 6618933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).