About 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid
4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid (PubChem CID 66189698) has the molecular formula C13H16N4O2S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid |
| PubChem CID | 66189698 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid |
| SMILES | [N-]=[N+]=NCCCNC1(C(=O)O)CCSc2ccccc21 |
| InChI | InChI=1S/C13H16N4O2S/c14-17-16-8-3-7-15-13(12(18)19)6-9-20-11-5-2-1-4-10(11)13/h1-2,4-5,15H,3,6-9H2,(H,18,19) |
| InChIKey | LGHIVBYTMPGWII-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid?
The IUPAC name of 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid (CID 66189698) is 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid.
What is the SMILES notation for 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid?
The canonical SMILES for 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid is [N-]=[N+]=NCCCNC1(C(=O)O)CCSc2ccccc21.
What is the InChIKey of 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid?
The InChIKey is LGHIVBYTMPGWII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2S/c14-17-16-8-3-7-15-13(12(18)19)6-9-20-11-5-2-1-4-10(11)13/h1-2,4-5,15H,3,6-9H2,(H,18,19).
What are the key properties of 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid?
4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid has a molecular weight of 292.36 g/mol, XLogP of 2.75, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-azidopropylamino)-2,3-dihydrothiochromene-4-carboxylic acid is sourced from PubChem (CID 66189698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).