C11H10ClN5O2 — CID 66189988
2-(2-azidoethylamino)-2-(7-chloro-1,3-benzodioxol-5-yl)acetonitrile (PubChem CID 66189988) has the molecular formula C11H10ClN5O2 and a molecular weight of 279.69 g/mol. Its IUPAC name is 2-(2-azidoethylamino)-2-(7-chloro-1,3-benzodioxol-5-yl)acetonitrile.
| Compound Name | 2-(2-azidoethylamino)-2-(7-chloro-1,3-benzodioxol-5-yl)acetonitrile |
|---|---|
| PubChem CID | 66189988 |
| Molecular Formula | C11H10ClN5O2 |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-(2-azidoethylamino)-2-(7-chloro-1,3-benzodioxol-5-yl)acetonitrile |
| SMILES | N#CC(NCCN=[N+]=[N-])c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C11H10ClN5O2/c12-8-3-7(4-10-11(8)19-6-18-10)9(5-13)15-1-2-16-17-14/h3-4,9,15H,1-2,6H2 |
| InChIKey | SOBLJVMBBTWVSP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|