C12H14ClFN4O2 — CID 66190499
methyl 2-(3-azidopropylamino)-2-(4-chloro-3-fluorophenyl)acetate (PubChem CID 66190499) has the molecular formula C12H14ClFN4O2 and a molecular weight of 300.72 g/mol. Its IUPAC name is methyl 2-(3-azidopropylamino)-2-(4-chloro-3-fluorophenyl)acetate.
| Compound Name | methyl 2-(3-azidopropylamino)-2-(4-chloro-3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 66190499 |
| Molecular Formula | C12H14ClFN4O2 |
| Molecular Weight | 300.72 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | methyl 2-(3-azidopropylamino)-2-(4-chloro-3-fluorophenyl)acetate |
| SMILES | COC(=O)C(NCCCN=[N+]=[N-])c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C12H14ClFN4O2/c1-20-12(19)11(16-5-2-6-17-18-15)8-3-4-9(13)10(14)7-8/h3-4,7,11,16H,2,5-6H2,1H3 |
| InChIKey | ZOFJAPVRCIMPHO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.72 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|