C12H15N5O — CID 66191049
2-(2-azidoethylamino)-1,3-dihydroindene-2-carboxamide (PubChem CID 66191049) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 2-(2-azidoethylamino)-1,3-dihydroindene-2-carboxamide.
| Compound Name | 2-(2-azidoethylamino)-1,3-dihydroindene-2-carboxamide |
|---|---|
| PubChem CID | 66191049 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-(2-azidoethylamino)-1,3-dihydroindene-2-carboxamide |
| SMILES | [N-]=[N+]=NCCNC1(C(N)=O)Cc2ccccc2C1 |
| InChI | InChI=1S/C12H15N5O/c13-11(18)12(15-5-6-16-17-14)7-9-3-1-2-4-10(9)8-12/h1-4,15H,5-8H2,(H2,13,18) |
| InChIKey | GRAZTIIJYOIDCN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|