About 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide
4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide (PubChem CID 66191314) has the molecular formula C13H17N5O2
and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide.
Molecular Properties
| Compound Name | 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide |
| PubChem CID | 66191314 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide |
| SMILES | [N-]=[N+]=NCCCNC1(C(N)=O)CCOc2ccccc21 |
| InChI | InChI=1S/C13H17N5O2/c14-12(19)13(16-7-3-8-17-18-15)6-9-20-11-5-2-1-4-10(11)13/h1-2,4-5,16H,3,6-9H2,(H2,14,19) |
| InChIKey | LYSPGXIINVYAPO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide?
The IUPAC name of 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide (CID 66191314) is 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide.
What is the SMILES notation for 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide?
The canonical SMILES for 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide is [N-]=[N+]=NCCCNC1(C(N)=O)CCOc2ccccc21.
What is the InChIKey of 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide?
The InChIKey is LYSPGXIINVYAPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O2/c14-12(19)13(16-7-3-8-17-18-15)6-9-20-11-5-2-1-4-10(11)13/h1-2,4-5,16H,3,6-9H2,(H2,14,19).
What are the key properties of 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide?
4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide has a molecular weight of 275.31 g/mol, XLogP of 1.44, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-azidopropylamino)-2,3-dihydrochromene-4-carboxamide is sourced from PubChem (CID 66191314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).