About methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate
methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate (PubChem CID 6619173) has the molecular formula C14H10N4O4
and a molecular weight of 298.26 g/mol. Its IUPAC name is methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate |
| PubChem CID | 6619173 |
| Molecular Formula | C14H10N4O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1-n1c(=O)[nH]c2ncccc2c1=O |
| InChI | InChI=1S/C14H10N4O4/c1-22-13(20)9-5-3-7-16-11(9)18-12(19)8-4-2-6-15-10(8)17-14(18)21/h2-7H,1H3,(H,15,17,21) |
| InChIKey | YKSKWEGIECUNFI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate?
The IUPAC name of methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate (CID 6619173) is methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate.
What is the SMILES notation for methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate?
The canonical SMILES for methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate is COC(=O)c1cccnc1-n1c(=O)[nH]c2ncccc2c1=O.
What is the InChIKey of methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate?
The InChIKey is YKSKWEGIECUNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O4/c1-22-13(20)9-5-3-7-16-11(9)18-12(19)8-4-2-6-15-10(8)17-14(18)21/h2-7H,1H3,(H,15,17,21).
What are the key properties of methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate?
methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate has a molecular weight of 298.26 g/mol, XLogP of 0.26, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-3-yl)pyridine-3-carboxylate is sourced from PubChem (CID 6619173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).