About 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide
2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide (PubChem CID 6619196) has the molecular formula C22H33N3O4
and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide.
Molecular Properties
| Compound Name | 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide |
| PubChem CID | 6619196 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide |
| SMILES | CCN1CCN(CCCNC(=O)COc2ccc3c(c2)C(=O)CC(C)(C)O3)CC1 |
| InChI | InChI=1S/C22H33N3O4/c1-4-24-10-12-25(13-11-24)9-5-8-23-21(27)16-28-17-6-7-20-18(14-17)19(26)15-22(2,3)29-20/h6-7,14H,4-5,8-13,15-16H2,1-3H3,(H,23,27) |
| InChIKey | ZKLZXFUWGYFTRR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide?
The IUPAC name of 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide (CID 6619196) is 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide.
What is the SMILES notation for 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide?
The canonical SMILES for 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide is CCN1CCN(CCCNC(=O)COc2ccc3c(c2)C(=O)CC(C)(C)O3)CC1.
What is the InChIKey of 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide?
The InChIKey is ZKLZXFUWGYFTRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33N3O4/c1-4-24-10-12-25(13-11-24)9-5-8-23-21(27)16-28-17-6-7-20-18(14-17)19(26)15-22(2,3)29-20/h6-7,14H,4-5,8-13,15-16H2,1-3H3,(H,23,27).
What are the key properties of 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide?
2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide has a molecular weight of 403.52 g/mol, XLogP of 1.95, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-dimethyl-4-oxo-3H-chromen-6-yl)oxy]-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide is sourced from PubChem (CID 6619196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).