C23H21N3O4S — CID 6619220
N-benzyl-2,3-dioxo-N-(2-phenylethyl)-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 6619220) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is N-benzyl-2,3-dioxo-N-(2-phenylethyl)-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-benzyl-2,3-dioxo-N-(2-phenylethyl)-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 6619220 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-benzyl-2,3-dioxo-N-(2-phenylethyl)-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)N(CCc3ccccc3)Cc3ccccc3)cc2[nH]c1=O |
| InChI | InChI=1S/C23H21N3O4S/c27-22-23(28)25-21-15-19(11-12-20(21)24-22)31(29,30)26(16-18-9-5-2-6-10-18)14-13-17-7-3-1-4-8-17/h1-12,15H,13-14,16H2,(H,24,27)(H,25,28) |
| InChIKey | GFLCGCMNJLNPQW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|