C11H14N4S — CID 66192447
N-[[1-(thiophen-2-ylmethyl)triazol-4-yl]methyl]cyclopropanamine (PubChem CID 66192447) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is N-[[1-(thiophen-2-ylmethyl)triazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-(thiophen-2-ylmethyl)triazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 66192447 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | N-[[1-(thiophen-2-ylmethyl)triazol-4-yl]methyl]cyclopropanamine |
| SMILES | c1csc(Cn2cc(CNC3CC3)nn2)c1 |
| InChI | InChI=1S/C11H14N4S/c1-2-11(16-5-1)8-15-7-10(13-14-15)6-12-9-3-4-9/h1-2,5,7,9,12H,3-4,6,8H2 |
| InChIKey | UIFUCEBVBXBTIW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |