C14H24N6 — CID 66192657
2-methyl-N-[[1-[(3-propan-2-ylimidazol-4-yl)methyl]triazol-4-yl]methyl]propan-2-amine (PubChem CID 66192657) has the molecular formula C14H24N6 and a molecular weight of 276.39 g/mol. Its IUPAC name is 2-methyl-N-[[1-[(3-propan-2-ylimidazol-4-yl)methyl]triazol-4-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[1-[(3-propan-2-ylimidazol-4-yl)methyl]triazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66192657 |
| Molecular Formula | C14H24N6 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2-methyl-N-[[1-[(3-propan-2-ylimidazol-4-yl)methyl]triazol-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)n1cncc1Cn1cc(CNC(C)(C)C)nn1 |
| InChI | InChI=1S/C14H24N6/c1-11(2)20-10-15-7-13(20)9-19-8-12(17-18-19)6-16-14(3,4)5/h7-8,10-11,16H,6,9H2,1-5H3 |
| InChIKey | WRYQDYFDUOZXII-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |