C17H12N4O — CID 661929
2,5-diphenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 661929) has the molecular formula C17H12N4O and a molecular weight of 288.31 g/mol. Its IUPAC name is 2,5-diphenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2,5-diphenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 661929 |
| Molecular Formula | C17H12N4O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2,5-diphenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(-c2ccccc2)nc2nc(-c3ccccc3)[nH]n12 |
| InChI | InChI=1S/C17H12N4O/c22-15-11-14(12-7-3-1-4-8-12)18-17-19-16(20-21(15)17)13-9-5-2-6-10-13/h1-11H,(H,18,19,20) |
| InChIKey | JTXNHQOMBLVMSD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |