C14H19FN4S — CID 66193179
N-[[1-[2-(2-fluorophenyl)sulfanylethyl]triazol-4-yl]methyl]propan-2-amine (PubChem CID 66193179) has the molecular formula C14H19FN4S and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[[1-[2-(2-fluorophenyl)sulfanylethyl]triazol-4-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-[2-(2-fluorophenyl)sulfanylethyl]triazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66193179 |
| Molecular Formula | C14H19FN4S |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | N-[[1-[2-(2-fluorophenyl)sulfanylethyl]triazol-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cn(CCSc2ccccc2F)nn1 |
| InChI | InChI=1S/C14H19FN4S/c1-11(2)16-9-12-10-19(18-17-12)7-8-20-14-6-4-3-5-13(14)15/h3-6,10-11,16H,7-9H2,1-2H3 |
| InChIKey | AIPMUEGRFKJXSA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |