About N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine
N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine (PubChem CID 66193273) has the molecular formula C11H20N4O2S
and a molecular weight of 272.37 g/mol. Its IUPAC name is N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine |
| PubChem CID | 66193273 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cn(C2CCS(=O)(=O)C2)nn1 |
| InChI | InChI=1S/C11H20N4O2S/c1-9(2)5-12-6-10-7-15(14-13-10)11-3-4-18(16,17)8-11/h7,9,11-12H,3-6,8H2,1-2H3 |
| InChIKey | ATWLJTVCGCIGNP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine?
The IUPAC name of N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine (CID 66193273) is N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine.
What is the SMILES notation for N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine?
The canonical SMILES for N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine is CC(C)CNCc1cn(C2CCS(=O)(=O)C2)nn1.
What is the InChIKey of N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine?
The InChIKey is ATWLJTVCGCIGNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O2S/c1-9(2)5-12-6-10-7-15(14-13-10)11-3-4-18(16,17)8-11/h7,9,11-12H,3-6,8H2,1-2H3.
What are the key properties of N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine?
N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine has a molecular weight of 272.37 g/mol, XLogP of 0.38, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(1,1-dioxothiolan-3-yl)triazol-4-yl]methyl]-2-methylpropan-1-amine is sourced from PubChem (CID 66193273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).