C13H14N6O — CID 66193670
3-[[4-(methylaminomethyl)triazol-1-yl]methyl]-1H-quinoxalin-2-one (PubChem CID 66193670) has the molecular formula C13H14N6O and a molecular weight of 270.30 g/mol. Its IUPAC name is 3-[[4-(methylaminomethyl)triazol-1-yl]methyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[[4-(methylaminomethyl)triazol-1-yl]methyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 66193670 |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-[[4-(methylaminomethyl)triazol-1-yl]methyl]-1H-quinoxalin-2-one |
| SMILES | CNCc1cn(Cc2nc3ccccc3[nH]c2=O)nn1 |
| InChI | InChI=1S/C13H14N6O/c1-14-6-9-7-19(18-17-9)8-12-13(20)16-11-5-3-2-4-10(11)15-12/h2-5,7,14H,6,8H2,1H3,(H,16,20) |
| InChIKey | DELHGLXWHDZLRY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |