C15H29N5O — CID 66194414
N-(3-methylbutyl)-2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]propanamide (PubChem CID 66194414) has the molecular formula C15H29N5O and a molecular weight of 295.43 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]propanamide.
| Compound Name | N-(3-methylbutyl)-2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]propanamide |
|---|---|
| PubChem CID | 66194414 |
| Molecular Formula | C15H29N5O |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.24 |
| IUPAC Name | N-(3-methylbutyl)-2-[4-[(2-methylpropylamino)methyl]triazol-1-yl]propanamide |
| SMILES | CC(C)CCNC(=O)C(C)n1cc(CNCC(C)C)nn1 |
| InChI | InChI=1S/C15H29N5O/c1-11(2)6-7-17-15(21)13(5)20-10-14(18-19-20)9-16-8-12(3)4/h10-13,16H,6-9H2,1-5H3,(H,17,21) |
| InChIKey | QXYWPEMTLQIISW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |