C16H24N2O2 — CID 66195481
N-(2-amino-4-ethoxycyclobutyl)-2,4,6-trimethylbenzamide (PubChem CID 66195481) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-(2-amino-4-ethoxycyclobutyl)-2,4,6-trimethylbenzamide.
| Compound Name | N-(2-amino-4-ethoxycyclobutyl)-2,4,6-trimethylbenzamide |
|---|---|
| PubChem CID | 66195481 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-(2-amino-4-ethoxycyclobutyl)-2,4,6-trimethylbenzamide |
| SMILES | CCOC1CC(N)C1NC(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H24N2O2/c1-5-20-13-8-12(17)15(13)18-16(19)14-10(3)6-9(2)7-11(14)4/h6-7,12-13,15H,5,8,17H2,1-4H3,(H,18,19) |
| InChIKey | ZJNCJQJEOGHLCY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |