About 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine
7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine (PubChem CID 66195571) has the molecular formula C11H16N4O2
and a molecular weight of 236.27 g/mol. Its IUPAC name is 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine.
Molecular Properties
| Compound Name | 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine |
| PubChem CID | 66195571 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine |
| SMILES | COc1ccnc(NC2C(N)C3CCOC32)n1 |
| InChI | InChI=1S/C11H16N4O2/c1-16-7-2-4-13-11(14-7)15-9-8(12)6-3-5-17-10(6)9/h2,4,6,8-10H,3,5,12H2,1H3,(H,13,14,15) |
| InChIKey | QTGPPHPPIOTPIJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine?
The IUPAC name of 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine (CID 66195571) is 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine.
What is the SMILES notation for 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine?
The canonical SMILES for 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine is COc1ccnc(NC2C(N)C3CCOC32)n1.
What is the InChIKey of 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine?
The InChIKey is QTGPPHPPIOTPIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O2/c1-16-7-2-4-13-11(14-7)15-9-8(12)6-3-5-17-10(6)9/h2,4,6,8-10H,3,5,12H2,1H3,(H,13,14,15).
What are the key properties of 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine?
7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine has a molecular weight of 236.27 g/mol, XLogP of 0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-N-(4-methoxypyrimidin-2-yl)-2-oxabicyclo[3.2.0]heptane-6,7-diamine is sourced from PubChem (CID 66195571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).