About 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole
4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole (PubChem CID 66196014) has the molecular formula C12H20N4S
and a molecular weight of 252.39 g/mol. Its IUPAC name is 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole |
| PubChem CID | 66196014 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole |
| SMILES | Cc1nc(N2CC(N3CCNCC3)C2)sc1C |
| InChI | InChI=1S/C12H20N4S/c1-9-10(2)17-12(14-9)16-7-11(8-16)15-5-3-13-4-6-15/h11,13H,3-8H2,1-2H3 |
| InChIKey | HFKHETFYNKDVEM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole?
The IUPAC name of 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole (CID 66196014) is 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole.
What is the SMILES notation for 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole?
The canonical SMILES for 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole is Cc1nc(N2CC(N3CCNCC3)C2)sc1C.
What is the InChIKey of 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole?
The InChIKey is HFKHETFYNKDVEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4S/c1-9-10(2)17-12(14-9)16-7-11(8-16)15-5-3-13-4-6-15/h11,13H,3-8H2,1-2H3.
What are the key properties of 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole?
4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole has a molecular weight of 252.39 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-(3-piperazin-1-ylazetidin-1-yl)-1,3-thiazole is sourced from PubChem (CID 66196014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).