About N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide
N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide (PubChem CID 66196514) has the molecular formula C9H13F3N2O2
and a molecular weight of 238.21 g/mol. Its IUPAC name is N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide.
Molecular Properties
| Compound Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide |
| PubChem CID | 66196514 |
| Molecular Formula | C9H13F3N2O2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide |
| SMILES | NC1C2CCOC2C1NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O2/c10-9(11,12)3-5(15)14-7-6(13)4-1-2-16-8(4)7/h4,6-8H,1-3,13H2,(H,14,15) |
| InChIKey | YLPMVDSCFPZBAI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide?
The IUPAC name of N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide (CID 66196514) is N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide.
What is the SMILES notation for N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide?
The canonical SMILES for N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide is NC1C2CCOC2C1NC(=O)CC(F)(F)F.
What is the InChIKey of N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide?
The InChIKey is YLPMVDSCFPZBAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2O2/c10-9(11,12)3-5(15)14-7-6(13)4-1-2-16-8(4)7/h4,6-8H,1-3,13H2,(H,14,15).
What are the key properties of N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide?
N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide has a molecular weight of 238.21 g/mol, XLogP of 0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-3,3,3-trifluoropropanamide is sourced from PubChem (CID 66196514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).