About N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide
N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide (PubChem CID 66196696) has the molecular formula C10H15F3N2O2
and a molecular weight of 252.24 g/mol. Its IUPAC name is N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide.
Molecular Properties
| Compound Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide |
| PubChem CID | 66196696 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide |
| SMILES | NC1C2CCOC2C1NC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O2/c11-10(12,13)3-1-6(16)15-8-7(14)5-2-4-17-9(5)8/h5,7-9H,1-4,14H2,(H,15,16) |
| InChIKey | MXGIJODRVWWYPW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide?
The IUPAC name of N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide (CID 66196696) is N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide.
What is the SMILES notation for N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide?
The canonical SMILES for N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide is NC1C2CCOC2C1NC(=O)CCC(F)(F)F.
What is the InChIKey of N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide?
The InChIKey is MXGIJODRVWWYPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3N2O2/c11-10(12,13)3-1-6(16)15-8-7(14)5-2-4-17-9(5)8/h5,7-9H,1-4,14H2,(H,15,16).
What are the key properties of N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide?
N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide has a molecular weight of 252.24 g/mol, XLogP of 0.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-4,4,4-trifluorobutanamide is sourced from PubChem (CID 66196696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).