C13H25N5O2 — CID 66196768
N-(ethylcarbamoyl)-2-(3-piperazin-1-ylazetidin-1-yl)propanamide (PubChem CID 66196768) has the molecular formula C13H25N5O2 and a molecular weight of 283.38 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-(3-piperazin-1-ylazetidin-1-yl)propanamide.
| Compound Name | N-(ethylcarbamoyl)-2-(3-piperazin-1-ylazetidin-1-yl)propanamide |
|---|---|
| PubChem CID | 66196768 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | N-(ethylcarbamoyl)-2-(3-piperazin-1-ylazetidin-1-yl)propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)N1CC(N2CCNCC2)C1 |
| InChI | InChI=1S/C13H25N5O2/c1-3-15-13(20)16-12(19)10(2)18-8-11(9-18)17-6-4-14-5-7-17/h10-11,14H,3-9H2,1-2H3,(H2,15,16,19,20) |
| InChIKey | AXSIXWDARCRDSD-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |