About 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine
3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine (PubChem CID 66197266) has the molecular formula C11H18N4O
and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine.
Molecular Properties
| Compound Name | 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine |
| PubChem CID | 66197266 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine |
| SMILES | CCOC1CC(N)C1Nc1ncc(C)cn1 |
| InChI | InChI=1S/C11H18N4O/c1-3-16-9-4-8(12)10(9)15-11-13-5-7(2)6-14-11/h5-6,8-10H,3-4,12H2,1-2H3,(H,13,14,15) |
| InChIKey | HAOLEZVWFVVRKR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine?
The IUPAC name of 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine (CID 66197266) is 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine.
What is the SMILES notation for 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine?
The canonical SMILES for 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine is CCOC1CC(N)C1Nc1ncc(C)cn1.
What is the InChIKey of 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine?
The InChIKey is HAOLEZVWFVVRKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O/c1-3-16-9-4-8(12)10(9)15-11-13-5-7(2)6-14-11/h5-6,8-10H,3-4,12H2,1-2H3,(H,13,14,15).
What are the key properties of 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine?
3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine has a molecular weight of 222.29 g/mol, XLogP of 0.70, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2-N-(5-methylpyrimidin-2-yl)cyclobutane-1,2-diamine is sourced from PubChem (CID 66197266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).