C14H20N2O3 — CID 66197269
2-(2-amino-4-ethoxycyclobutyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 66197269) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(2-amino-4-ethoxycyclobutyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(2-amino-4-ethoxycyclobutyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 66197269 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(2-amino-4-ethoxycyclobutyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCOC1CC(N)C1N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C14H20N2O3/c1-2-19-11-7-10(15)12(11)16-13(17)8-5-3-4-6-9(8)14(16)18/h3-4,8-12H,2,5-7,15H2,1H3 |
| InChIKey | MVFAADRGCKLVBZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|