C19H20N2O6S — CID 6619734
ethyl 2-[6-[benzyl(methyl)sulfamoyl]-2-oxo-1,3-benzoxazol-3-yl]acetate (PubChem CID 6619734) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is ethyl 2-[6-[benzyl(methyl)sulfamoyl]-2-oxo-1,3-benzoxazol-3-yl]acetate.
| Compound Name | ethyl 2-[6-[benzyl(methyl)sulfamoyl]-2-oxo-1,3-benzoxazol-3-yl]acetate |
|---|---|
| PubChem CID | 6619734 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | ethyl 2-[6-[benzyl(methyl)sulfamoyl]-2-oxo-1,3-benzoxazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1c(=O)oc2cc(S(=O)(=O)N(C)Cc3ccccc3)ccc21 |
| InChI | InChI=1S/C19H20N2O6S/c1-3-26-18(22)13-21-16-10-9-15(11-17(16)27-19(21)23)28(24,25)20(2)12-14-7-5-4-6-8-14/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | JKHDNQYWEPIBQS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |