About 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine
3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine (PubChem CID 66197643) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine.
Molecular Properties
| Compound Name | 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine |
| PubChem CID | 66197643 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine |
| SMILES | CCOC1CC(N)C1Nc1cc(C)ccn1 |
| InChI | InChI=1S/C12H19N3O/c1-3-16-10-7-9(13)12(10)15-11-6-8(2)4-5-14-11/h4-6,9-10,12H,3,7,13H2,1-2H3,(H,14,15) |
| InChIKey | XUWVVSCPRPQOSQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine?
The IUPAC name of 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine (CID 66197643) is 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine.
What is the SMILES notation for 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine?
The canonical SMILES for 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine is CCOC1CC(N)C1Nc1cc(C)ccn1.
What is the InChIKey of 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine?
The InChIKey is XUWVVSCPRPQOSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c1-3-16-10-7-9(13)12(10)15-11-6-8(2)4-5-14-11/h4-6,9-10,12H,3,7,13H2,1-2H3,(H,14,15).
What are the key properties of 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine?
3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine has a molecular weight of 221.30 g/mol, XLogP of 1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2-N-(4-methyl-2-pyridinyl)cyclobutane-1,2-diamine is sourced from PubChem (CID 66197643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).