About 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine
4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine (PubChem CID 66197924) has the molecular formula C15H9BrF2N2O
and a molecular weight of 351.15 g/mol. Its IUPAC name is 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine |
| PubChem CID | 66197924 |
| Molecular Formula | C15H9BrF2N2O |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2cc(F)ccc2F)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H9BrF2N2O/c16-9-3-1-8(2-4-9)13-14(21-20-15(13)19)11-7-10(17)5-6-12(11)18/h1-7H,(H2,19,20) |
| InChIKey | WLPDIGCFOBJIAU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine?
The IUPAC name of 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine (CID 66197924) is 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine.
What is the SMILES notation for 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine?
The canonical SMILES for 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine is Nc1noc(-c2cc(F)ccc2F)c1-c1ccc(Br)cc1.
What is the InChIKey of 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine?
The InChIKey is WLPDIGCFOBJIAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9BrF2N2O/c16-9-3-1-8(2-4-9)13-14(21-20-15(13)19)11-7-10(17)5-6-12(11)18/h1-7H,(H2,19,20).
What are the key properties of 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine?
4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine has a molecular weight of 351.15 g/mol, XLogP of 4.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-5-(2,5-difluorophenyl)-1,2-oxazol-3-amine is sourced from PubChem (CID 66197924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).