About 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine
5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine (PubChem CID 66198036) has the molecular formula C11H9F2N3O3
and a molecular weight of 269.21 g/mol. Its IUPAC name is 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine |
| PubChem CID | 66198036 |
| Molecular Formula | C11H9F2N3O3 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine |
| SMILES | CCc1c(N)noc1-c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9F2N3O3/c1-2-5-10(19-15-11(5)14)6-3-7(12)8(13)4-9(6)16(17)18/h3-4H,2H2,1H3,(H2,14,15) |
| InChIKey | YIWSYFNABTUSQM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine?
The IUPAC name of 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine (CID 66198036) is 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine.
What is the SMILES notation for 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine?
The canonical SMILES for 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine is CCc1c(N)noc1-c1cc(F)c(F)cc1[N+](=O)[O-].
What is the InChIKey of 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine?
The InChIKey is YIWSYFNABTUSQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2N3O3/c1-2-5-10(19-15-11(5)14)6-3-7(12)8(13)4-9(6)16(17)18/h3-4H,2H2,1H3,(H2,14,15).
What are the key properties of 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine?
5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine has a molecular weight of 269.21 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-difluoro-2-nitrophenyl)-4-ethyl-1,2-oxazol-3-amine is sourced from PubChem (CID 66198036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).