C12H9FN4O — CID 66198144
4-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-1,2-oxazol-3-amine (PubChem CID 66198144) has the molecular formula C12H9FN4O and a molecular weight of 244.23 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-1,2-oxazol-3-amine.
| Compound Name | 4-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66198144 |
| Molecular Formula | C12H9FN4O |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4-(4-fluorophenyl)-5-(1H-pyrazol-5-yl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccn[nH]2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C12H9FN4O/c13-8-3-1-7(2-4-8)10-11(18-17-12(10)14)9-5-6-15-16-9/h1-6H,(H2,14,17)(H,15,16) |
| InChIKey | KAWGDCQORMOBSG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |