C16H14N4O3 — CID 6619859
N-(2-cyanoethyl)-N-methyl-2-(4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide (PubChem CID 6619859) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-methyl-2-(4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide.
| Compound Name | N-(2-cyanoethyl)-N-methyl-2-(4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 6619859 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-(2-cyanoethyl)-N-methyl-2-(4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide |
| SMILES | CN(CCC#N)C(=O)Cn1ncc2c(=O)oc3ccccc3c21 |
| InChI | InChI=1S/C16H14N4O3/c1-19(8-4-7-17)14(21)10-20-15-11-5-2-3-6-13(11)23-16(22)12(15)9-18-20/h2-3,5-6,9H,4,8,10H2,1H3 |
| InChIKey | GSSAPSLKFODHAV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|