About 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine
5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine (PubChem CID 66198713) has the molecular formula C13H10N2O2
and a molecular weight of 226.24 g/mol. Its IUPAC name is 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine |
| PubChem CID | 66198713 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccco2)c1-c1ccccc1 |
| InChI | InChI=1S/C13H10N2O2/c14-13-11(9-5-2-1-3-6-9)12(17-15-13)10-7-4-8-16-10/h1-8H,(H2,14,15) |
| InChIKey | VIGYNMJPASCTDD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine?
The IUPAC name of 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine (CID 66198713) is 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine.
What is the SMILES notation for 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine?
The canonical SMILES for 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine is Nc1noc(-c2ccco2)c1-c1ccccc1.
What is the InChIKey of 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine?
The InChIKey is VIGYNMJPASCTDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2/c14-13-11(9-5-2-1-3-6-9)12(17-15-13)10-7-4-8-16-10/h1-8H,(H2,14,15).
What are the key properties of 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine?
5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine has a molecular weight of 226.24 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-2-yl)-4-phenyl-1,2-oxazol-3-amine is sourced from PubChem (CID 66198713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).