C17H15BrN2O — CID 66199515
4-(4-bromophenyl)-5-(3,5-dimethylphenyl)-1,2-oxazol-3-amine (PubChem CID 66199515) has the molecular formula C17H15BrN2O and a molecular weight of 343.22 g/mol. Its IUPAC name is 4-(4-bromophenyl)-5-(3,5-dimethylphenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(4-bromophenyl)-5-(3,5-dimethylphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66199515 |
| Molecular Formula | C17H15BrN2O |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 4-(4-bromophenyl)-5-(3,5-dimethylphenyl)-1,2-oxazol-3-amine |
| SMILES | Cc1cc(C)cc(-c2onc(N)c2-c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H15BrN2O/c1-10-7-11(2)9-13(8-10)16-15(17(19)20-21-16)12-3-5-14(18)6-4-12/h3-9H,1-2H3,(H2,19,20) |
| InChIKey | GCJKTBSUPTXEMF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |