C16H19FN2O — CID 66199569
5-cycloheptyl-4-(3-fluorophenyl)-1,2-oxazol-3-amine (PubChem CID 66199569) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is 5-cycloheptyl-4-(3-fluorophenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-cycloheptyl-4-(3-fluorophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66199569 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 5-cycloheptyl-4-(3-fluorophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(C2CCCCCC2)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C16H19FN2O/c17-13-9-5-8-12(10-13)14-15(20-19-16(14)18)11-6-3-1-2-4-7-11/h5,8-11H,1-4,6-7H2,(H2,18,19) |
| InChIKey | YOVDGHOKELDCCW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |