About 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine
5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine (PubChem CID 66200021) has the molecular formula C13H7BrCl2N2O2
and a molecular weight of 374.02 g/mol. Its IUPAC name is 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine |
| PubChem CID | 66200021 |
| Molecular Formula | C13H7BrCl2N2O2 |
| Molecular Weight | 374.02 g/mol |
| Exact Mass | 371.91 |
| IUPAC Name | 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccc(Br)o2)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H7BrCl2N2O2/c14-10-4-3-9(19-10)12-11(13(17)18-20-12)6-1-2-7(15)8(16)5-6/h1-5H,(H2,17,18) |
| InChIKey | LOBJNPOFMACCBB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.02 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine?
The IUPAC name of 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine (CID 66200021) is 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine.
What is the SMILES notation for 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine?
The canonical SMILES for 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine is Nc1noc(-c2ccc(Br)o2)c1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine?
The InChIKey is LOBJNPOFMACCBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrCl2N2O2/c14-10-4-3-9(19-10)12-11(13(17)18-20-12)6-1-2-7(15)8(16)5-6/h1-5H,(H2,17,18).
What are the key properties of 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine?
5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine has a molecular weight of 374.02 g/mol, XLogP of 5.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-bromofuran-2-yl)-4-(3,4-dichlorophenyl)-1,2-oxazol-3-amine is sourced from PubChem (CID 66200021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).