C10H13N5 — CID 6620049
6-piperidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 6620049) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 6-piperidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-piperidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 6620049 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 6-piperidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | c1cc2nncn2nc1N1CCCCC1 |
| InChI | InChI=1S/C10H13N5/c1-2-6-14(7-3-1)10-5-4-9-12-11-8-15(9)13-10/h4-5,8H,1-3,6-7H2 |
| InChIKey | AROVKFICFQJHOO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |