About 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide
8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 6620052) has the molecular formula C19H22N2O2S
and a molecular weight of 342.46 g/mol. Its IUPAC name is 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide.
Molecular Properties
| Compound Name | 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide |
| PubChem CID | 6620052 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc2c(=O)[nH]c3ccc(C)cc3c2s1 |
| InChI | InChI=1S/C19H22N2O2S/c1-4-8-21(9-5-2)19(23)16-11-14-17(24-16)13-10-12(3)6-7-15(13)20-18(14)22/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,20,22) |
| InChIKey | UFXXFNHNCYDIKX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide?
The IUPAC name of 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide (CID 6620052) is 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide.
What is the SMILES notation for 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide?
The canonical SMILES for 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide is CCCN(CCC)C(=O)c1cc2c(=O)[nH]c3ccc(C)cc3c2s1.
What is the InChIKey of 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide?
The InChIKey is UFXXFNHNCYDIKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2S/c1-4-8-21(9-5-2)19(23)16-11-14-17(24-16)13-10-12(3)6-7-15(13)20-18(14)22/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,20,22).
What are the key properties of 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide?
8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide has a molecular weight of 342.46 g/mol, XLogP of 4.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4-oxo-N,N-dipropyl-5H-thieno[3,2-c]quinoline-2-carboxamide is sourced from PubChem (CID 6620052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).