About 2-(difluoromethyl)-1,3-benzothiazol-6-amine
2-(difluoromethyl)-1,3-benzothiazol-6-amine (PubChem CID 66201315) has the molecular formula C8H6F2N2S
and a molecular weight of 200.21 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,3-benzothiazol-6-amine.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-1,3-benzothiazol-6-amine |
| PubChem CID | 66201315 |
| Molecular Formula | C8H6F2N2S |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 2-(difluoromethyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(C(F)F)sc2c1 |
| InChI | InChI=1S/C8H6F2N2S/c9-7(10)8-12-5-2-1-4(11)3-6(5)13-8/h1-3,7H,11H2 |
| InChIKey | FOFMNMOYBHDIDQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(difluoromethyl)-1,3-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-1,3-benzothiazol-6-amine?
The IUPAC name of 2-(difluoromethyl)-1,3-benzothiazol-6-amine (CID 66201315) is 2-(difluoromethyl)-1,3-benzothiazol-6-amine.
What is the SMILES notation for 2-(difluoromethyl)-1,3-benzothiazol-6-amine?
The canonical SMILES for 2-(difluoromethyl)-1,3-benzothiazol-6-amine is Nc1ccc2nc(C(F)F)sc2c1.
What is the InChIKey of 2-(difluoromethyl)-1,3-benzothiazol-6-amine?
The InChIKey is FOFMNMOYBHDIDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2N2S/c9-7(10)8-12-5-2-1-4(11)3-6(5)13-8/h1-3,7H,11H2.
What are the key properties of 2-(difluoromethyl)-1,3-benzothiazol-6-amine?
2-(difluoromethyl)-1,3-benzothiazol-6-amine has a molecular weight of 200.21 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-1,3-benzothiazol-6-amine is sourced from PubChem (CID 66201315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).