About [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone
[4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone (PubChem CID 6620144) has the molecular formula C19H20N4OS
and a molecular weight of 352.46 g/mol. Its IUPAC name is [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone |
| PubChem CID | 6620144 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(CSc2nc3ccncc3[nH]2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C19H20N4OS/c24-18(23-10-2-1-3-11-23)15-6-4-14(5-7-15)13-25-19-21-16-8-9-20-12-17(16)22-19/h4-9,12H,1-3,10-11,13H2,(H,21,22) |
| InChIKey | KJGLNAGHMBUATJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone?
The IUPAC name of [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone (CID 6620144) is [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone.
What is the SMILES notation for [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone?
The canonical SMILES for [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone is O=C(c1ccc(CSc2nc3ccncc3[nH]2)cc1)N1CCCCC1.
What is the InChIKey of [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone?
The InChIKey is KJGLNAGHMBUATJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4OS/c24-18(23-10-2-1-3-11-23)15-6-4-14(5-7-15)13-25-19-21-16-8-9-20-12-17(16)22-19/h4-9,12H,1-3,10-11,13H2,(H,21,22).
What are the key properties of [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone?
[4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone has a molecular weight of 352.46 g/mol, XLogP of 3.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenyl]-piperidin-1-ylmethanone is sourced from PubChem (CID 6620144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).