C14H9F2N3O — CID 66201497
4-(2,4-difluorophenyl)-5-pyridin-4-yl-1,2-oxazol-3-amine (PubChem CID 66201497) has the molecular formula C14H9F2N3O and a molecular weight of 273.24 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-5-pyridin-4-yl-1,2-oxazol-3-amine.
| Compound Name | 4-(2,4-difluorophenyl)-5-pyridin-4-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66201497 |
| Molecular Formula | C14H9F2N3O |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-(2,4-difluorophenyl)-5-pyridin-4-yl-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccncc2)c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C14H9F2N3O/c15-9-1-2-10(11(16)7-9)12-13(20-19-14(12)17)8-3-5-18-6-4-8/h1-7H,(H2,17,19) |
| InChIKey | BORIDRXFAJVQIV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |