About N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide
N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide (PubChem CID 6620175) has the molecular formula C20H16FNO3S2
and a molecular weight of 401.48 g/mol. Its IUPAC name is N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| PubChem CID | 6620175 |
| Molecular Formula | C20H16FNO3S2 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| SMILES | CCN(C(=O)c1cc2c(s1)-c1ccccc1S(=O)(=O)C2)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H16FNO3S2/c1-2-22(15-9-7-14(21)8-10-15)20(23)17-11-13-12-27(24,25)18-6-4-3-5-16(18)19(13)26-17/h3-11H,2,12H2,1H3 |
| InChIKey | FCORQCWVWQYLLJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide?
The IUPAC name of N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide (CID 6620175) is N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide.
What is the SMILES notation for N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide?
The canonical SMILES for N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide is CCN(C(=O)c1cc2c(s1)-c1ccccc1S(=O)(=O)C2)c1ccc(F)cc1.
What is the InChIKey of N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide?
The InChIKey is FCORQCWVWQYLLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FNO3S2/c1-2-22(15-9-7-14(21)8-10-15)20(23)17-11-13-12-27(24,25)18-6-4-3-5-16(18)19(13)26-17/h3-11H,2,12H2,1H3.
What are the key properties of N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide?
N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide has a molecular weight of 401.48 g/mol, XLogP of 4.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(4-fluorophenyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide is sourced from PubChem (CID 6620175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).