About 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine
1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine (PubChem CID 66202573) has the molecular formula C9H17F2N3
and a molecular weight of 205.25 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine |
| PubChem CID | 66202573 |
| Molecular Formula | C9H17F2N3 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.14 |
| IUPAC Name | 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine |
| SMILES | FC(F)CN1CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C9H17F2N3/c10-9(11)7-13-1-3-14(4-2-13)8-5-12-6-8/h8-9,12H,1-7H2 |
| InChIKey | WBIIMIIULUUSCA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine?
The IUPAC name of 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine (CID 66202573) is 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine.
What is the SMILES notation for 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine?
The canonical SMILES for 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine is FC(F)CN1CCN(C2CNC2)CC1.
What is the InChIKey of 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine?
The InChIKey is WBIIMIIULUUSCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2N3/c10-9(11)7-13-1-3-14(4-2-13)8-5-12-6-8/h8-9,12H,1-7H2.
What are the key properties of 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine?
1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine has a molecular weight of 205.25 g/mol, XLogP of -0.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)-4-(2,2-difluoroethyl)piperazine is sourced from PubChem (CID 66202573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).