C17H17N5O3 — CID 662026
N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-3,4-dimethoxybenzamide (PubChem CID 662026) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-3,4-dimethoxybenzamide.
| Compound Name | N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 662026 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nc(N)n(-c3ccccc3)n2)cc1OC |
| InChI | InChI=1S/C17H17N5O3/c1-24-13-9-8-11(10-14(13)25-2)15(23)19-17-20-16(18)22(21-17)12-6-4-3-5-7-12/h3-10H,1-2H3,(H3,18,19,20,21,23) |
| InChIKey | OMISMCYZBFIOJV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |