C14H23N5OS — CID 66202912
[4-(azetidin-3-yl)piperazin-1-yl]-(4-tert-butylthiadiazol-5-yl)methanone (PubChem CID 66202912) has the molecular formula C14H23N5OS and a molecular weight of 309.44 g/mol. Its IUPAC name is [4-(azetidin-3-yl)piperazin-1-yl]-(4-tert-butylthiadiazol-5-yl)methanone.
| Compound Name | [4-(azetidin-3-yl)piperazin-1-yl]-(4-tert-butylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 66202912 |
| Molecular Formula | C14H23N5OS |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | [4-(azetidin-3-yl)piperazin-1-yl]-(4-tert-butylthiadiazol-5-yl)methanone |
| SMILES | CC(C)(C)c1nnsc1C(=O)N1CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C14H23N5OS/c1-14(2,3)12-11(21-17-16-12)13(20)19-6-4-18(5-7-19)10-8-15-9-10/h10,15H,4-9H2,1-3H3 |
| InChIKey | BVJPMDSQSCOUNK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |