About 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine
2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine (PubChem CID 66203630) has the molecular formula C14H16N4S
and a molecular weight of 272.38 g/mol. Its IUPAC name is 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine.
Molecular Properties
| Compound Name | 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine |
| PubChem CID | 66203630 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine |
| SMILES | CCc1cc(-c2nc3ccc(N)cc3s2)n(CC)n1 |
| InChI | InChI=1S/C14H16N4S/c1-3-10-8-12(18(4-2)17-10)14-16-11-6-5-9(15)7-13(11)19-14/h5-8H,3-4,15H2,1-2H3 |
| InChIKey | SIJRSQOFKXKWBY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine?
The IUPAC name of 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine (CID 66203630) is 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine.
What is the SMILES notation for 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine?
The canonical SMILES for 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine is CCc1cc(-c2nc3ccc(N)cc3s2)n(CC)n1.
What is the InChIKey of 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine?
The InChIKey is SIJRSQOFKXKWBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4S/c1-3-10-8-12(18(4-2)17-10)14-16-11-6-5-9(15)7-13(11)19-14/h5-8H,3-4,15H2,1-2H3.
What are the key properties of 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine?
2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine has a molecular weight of 272.38 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-diethylpyrazol-5-yl)-1,3-benzothiazol-6-amine is sourced from PubChem (CID 66203630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).